CAS 1698027-20-1 appears in our catalog under these names: tert–Butyl 4–(7–bromo–6–chloro–8–fluoroquinazolin–4–yl)piperazine–1–carboxylate, 1588-A4/ 98%, 1588-A4 95%, tert-Butyl 4-(7-bromo-6-chloro-8-fluoroquinazolin-4-yl)piperazine-1-carboxylate, 98%, 98%, ARS-1620 intermediate. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 25mg, 5mg, 2mg, 10mg, 50mg, 100mg, 200mg.
Tert-butyl 4-(7-bromo-6-chloro-8-fluoroquinazolin-4-yl)piperazine-1-carboxylate (CAS 1698027-20-1) is a chemical compound with the molecular formula C17H19BrClFN4O2 and a molecular weight of 445.7 g/mol. IUPAC name: tert-butyl 4-(7-bromo-6-chloro-8-fluoroquinazolin-4-yl)piperazine-1-carboxylate. InChIKey: WKUMTSOYOFGRSM-UHFFFAOYSA-N.
| Molecular formula | C17H19BrClFN4O2 |
|---|---|
| Molecular weight | 445.7 g/mol |
| IUPAC name | tert-butyl 4-(7-bromo-6-chloro-8-fluoroquinazolin-4-yl)piperazine-1-carboxylate |
| InChIKey | WKUMTSOYOFGRSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=NC=NC3=C(C(=C(C=C32)Cl)Br)F |
Computed by PubChem (NCBI)