cas: 516493-93-9 — see every product listed under this CAS number, including other names
17-Azido-3,6,9,12,15-pentaoxaheptadecan-1-amine, 98%, 98% (CAS 516493-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDG5-100mg |
| cas | 516493-93-9 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 578.00 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1614.80 Pln | |
| Chemat | 50g | 2958.80 Pln | |
| Chemat | 100g | 5229.20 Pln | |
| Chemat | 250g | 7139.60 Pln | |
| Chemat | 500g | 10459.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine (CAS 516493-93-9) is a chemical compound with the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. IUPAC name: 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine. InChIKey: SVPBRIZYFJFLOL-UHFFFAOYSA-N.
| Molecular formula | C12H26N4O5 |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
| InChIKey | SVPBRIZYFJFLOL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCN=[N+]=[N-])N |
Computed by PubChem (NCBI)