CAS 71122-29-7 is the registry number for Nebramine Disulfate. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Trans-(3R,6R)-4,6-diamino-3-[(2R,5S)-3-amino-6-(aminomethyl)-5-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol (CAS 71122-29-7) is a chemical compound with the molecular formula C12H26N4O5 and a molecular weight of 306.36 g/mol. IUPAC name: trans-(3R,6R)-4,6-diamino-3-[(2R,5S)-3-amino-6-(aminomethyl)-5-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol. InChIKey: QBWLTQZEVUXXSR-PZLNIEEDSA-N.
| Molecular formula | C12H26N4O5 |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | trans-(3R,6R)-4,6-diamino-3-[(2R,5S)-3-amino-6-(aminomethyl)-5-hydroxyoxan-2-yl]oxycyclohexane-1,2-diol |
| InChIKey | QBWLTQZEVUXXSR-PZLNIEEDSA-N |
| SMILES | C1[C@H](C(C([C@@H](C1N)O[C@@H]2C(C[C@@H](C(O2)CN)O)N)O)O)N |
Computed by PubChem (NCBI)