CAS 474945-24-9 appears in our catalog under these names: 1,2-Dioleoyl-sn-glycero-3-ethylphosphocholine Chloride Salt, 18:1 EPC chloride, 18:1 EPC chloride, 18:1 EPC (CL SALT), 18:1 EPC (chloride), 99.0%. Offered by: TRC, TargetMol, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 200MG, 10 mg, 25 mg, 5 mg.
2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-ethoxyphosphoryl]oxyethyl-trimethylazanium chloride (CAS 474945-24-9) is a chemical compound with the molecular formula C46H89ClNO8P and a molecular weight of 850.6 g/mol. IUPAC name: 2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-ethoxyphosphoryl]oxyethyl-trimethylazanium chloride. InChIKey: LXTQBOAODSPEHG-NATHRRJOSA-M.
| Molecular formula | C46H89ClNO8P |
|---|---|
| Molecular weight | 850.6 g/mol |
| IUPAC name | 2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-ethoxyphosphoryl]oxyethyl-trimethylazanium chloride |
| InChIKey | LXTQBOAODSPEHG-NATHRRJOSA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCC)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-] |
Computed by PubChem (NCBI)