Products 474945-24-9

CAS 474945-24-9 appears in our catalog under these names: 1,2-Dioleoyl-sn-glycero-3-ethylphosphocholine Chloride Salt, 18:1 EPC chloride, 18:1 EPC chloride, 18:1 EPC chloride 98%, 18:1 EPC (CL SALT). Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 100mg, 5mg, 10mg, 25mg, 50mg, 250mg, 200MG, 10 mg.

Structural formula: {0} (CAS {1})

2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-ethoxyphosphoryl]oxyethyl-trimethylazanium chloride (CAS 474945-24-9) is a chemical compound with the molecular formula C46H89ClNO8P and a molecular weight of 850.6 g/mol. IUPAC name: 2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-ethoxyphosphoryl]oxyethyl-trimethylazanium chloride. InChIKey: LXTQBOAODSPEHG-NATHRRJOSA-M.

Identity
Molecular formulaC46H89ClNO8P
Molecular weight850.6 g/mol
IUPAC name2-[[(2R)-2,3-bis[[(Z)-octadec-9-enoyl]oxy]propoxy]-ethoxyphosphoryl]oxyethyl-trimethylazanium chloride
InChIKeyLXTQBOAODSPEHG-NATHRRJOSA-M
SMILESCCCCCCCC/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCC)OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cl-]

Computed by PubChem (NCBI)