CAS 62972-61-6 appears in our catalog under these names: 1H-1,2,3-Benzotriazole-7-carboxylic acid, 95%, 1H-1,2,3-Benzotriazole-7-carboxylic Acid, 4–carboxybenzotriazole, 3H-Benzotriazole-4-carboxylic acid, 1H-benzotriazole-7-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 500mg, 0,5g.
2H-benzotriazole-4-carboxylic acid (CAS 62972-61-6) is a chemical compound with the molecular formula C7H5N3O2 and a molecular weight of 163.13 g/mol. IUPAC name: 2H-benzotriazole-4-carboxylic acid. InChIKey: KFJDQPJLANOOOB-UHFFFAOYSA-N.
| Molecular formula | C7H5N3O2 |
|---|---|
| Molecular weight | 163.13 g/mol |
| IUPAC name | 2H-benzotriazole-4-carboxylic acid |
| InChIKey | KFJDQPJLANOOOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNN=C2C(=C1)C(=O)O |
Computed by PubChem (NCBI)