cas: 442685-53-2 — see every product listed under this CAS number, including other names
1H-INDOLE-1-CARBOXYLIC ACID, 5-(BROMOMETHYL)-, 1,1-DIMETHYLETHYL ESTER, 97% (CAS 442685-53-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F814732-100MG |
| cas | 442685-53-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 721.64 Pln | |
| Fluorochem | 250mg | 1039.24 Pln | |
| Fluorochem | 500mg | 1611.95 Pln | |
| Fluorochem | 1g | 2814.65 Pln | |
| Fluorochem | 5g | 8286.68 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 5-(bromomethyl)indole-1-carboxylate (CAS 442685-53-2) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 5-(bromomethyl)indole-1-carboxylate. InChIKey: YDMDECBIBMTDPS-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | tert-butyl 5-(bromomethyl)indole-1-carboxylate |
| InChIKey | YDMDECBIBMTDPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2)CBr |
Computed by PubChem (NCBI)