cas: 442685-53-2 — see every product listed under this CAS number, including other names
tert-Butyl 5-(bromomethyl)-1H-indole-1-carboxylate, 97%, 97% (CAS 442685-53-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DL7J-100mg |
| cas | 442685-53-2 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 573.20 Pln | |
| Chemat | 500mg | 899.60 Pln | |
| Chemat | 1g | 1456.40 Pln | |
| Chemat | 5g | 4240.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-(bromomethyl)indole-1-carboxylate (CAS 442685-53-2) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 5-(bromomethyl)indole-1-carboxylate. InChIKey: YDMDECBIBMTDPS-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | tert-butyl 5-(bromomethyl)indole-1-carboxylate |
| InChIKey | YDMDECBIBMTDPS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=CC(=C2)CBr |
Computed by PubChem (NCBI)