cas: 848357-46-0 — see every product listed under this CAS number, including other names
1H-Indole-1,6-dicarboxylic acid, 2-borono-, 1-(1,1-dimethylethyl) 6-methyl ester, 98%, 98% (CAS 848357-46-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BEG-100mg |
| cas | 848357-46-0 |
| size | 100mg |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 362.00 Pln | |
| Chemat | 1g | 846.80 Pln | |
| Chemat | 5g | 3011.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[6-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 848357-46-0) is a chemical compound with the molecular formula C15H18BNO6 and a molecular weight of 319.12 g/mol. IUPAC name: [6-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: KQMBSTUEOCJFKS-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO6 |
|---|---|
| Molecular weight | 319.12 g/mol |
| IUPAC name | [6-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | KQMBSTUEOCJFKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)C(=O)OC)(O)O |
Computed by PubChem (NCBI)