CAS 848357-46-0 appears in our catalog under these names: 1-BOC-6-(methoxycarbonyl)indole-2-boronic acid, 98%, 1-BOC-6-(methoxycarbonyl)indole-2-boronic acid, 95-<97%, 1-BOC-6-(methoxycarbonyl)indole-2-boronic acid, ≥97-<99%, (1-(tert-Butoxycarbonyl)-6-(methoxycarbonyl)-1H-indol-2-yl)boronic acid 98%, 1H-Indole-1,6-dicarboxylic acid, 2-borono-, 1-(1,1-dimethylethyl) 6-methyl ester, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 2,5g, 10g, 25g, 50g, 100mg.
[6-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid (CAS 848357-46-0) is a chemical compound with the molecular formula C15H18BNO6 and a molecular weight of 319.12 g/mol. IUPAC name: [6-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid. InChIKey: KQMBSTUEOCJFKS-UHFFFAOYSA-N.
| Molecular formula | C15H18BNO6 |
|---|---|
| Molecular weight | 319.12 g/mol |
| IUPAC name | [6-methoxycarbonyl-1-[(2-methylpropan-2-yl)oxycarbonyl]indol-2-yl]boronic acid |
| InChIKey | KQMBSTUEOCJFKS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(N1C(=O)OC(C)(C)C)C=C(C=C2)C(=O)OC)(O)O |
Computed by PubChem (NCBI)