cas: 207572-69-8 — see every product listed under this CAS number, including other names
1H-Indole-3-carboxylic acid, 2-(1-piperidinyl)ethyl ester, hydrochloride (1:1), 99%, 99% (CAS 207572-69-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113J69-1mg |
| cas | 207572-69-8 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 146.00 Pln | |
| Chemat | 5mg | 280.40 Pln | |
| Chemat | 10mg | 410.00 Pln | |
| Chemat | 25mg | 477.20 Pln | |
| Chemat | 50mg | 510.80 Pln | |
| Chemat | 100mg | 822.80 Pln | |
| Chemat | 250mg | 1355.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
2-piperidin-1-ylethyl 1H-indole-3-carboxylate;hydrochloride (CAS 207572-69-8) is a chemical compound with the molecular formula C16H21ClN2O2 and a molecular weight of 308.80 g/mol. IUPAC name: 2-piperidin-1-ylethyl 1H-indole-3-carboxylate;hydrochloride. InChIKey: LYMBEMCUJNDSBZ-UHFFFAOYSA-N.
| Molecular formula | C16H21ClN2O2 |
|---|---|
| Molecular weight | 308.80 g/mol |
| IUPAC name | 2-piperidin-1-ylethyl 1H-indole-3-carboxylate;hydrochloride |
| InChIKey | LYMBEMCUJNDSBZ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCOC(=O)C2=CNC3=CC=CC=C32.Cl |
Computed by PubChem (NCBI)