cas: 70216-78-3 — see every product listed under this CAS number, including other names
1H-Isoindole-1,3(2H)-dione,2-((3-fluorophenyl)methyl)-, 95% (CAS 70216-78-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A725575-1g |
| cas | 70216-78-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2693.53 Pln | |
| AmBeed | 250mg | 2081.59 Pln | |
| AmBeed | 25g | 25205.11 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[(3-fluorophenyl)methyl]isoindole-1,3-dione (CAS 70216-78-3) is a chemical compound with the molecular formula C15H10FNO2 and a molecular weight of 255.24 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]isoindole-1,3-dione. InChIKey: APYCABOCKVIWAT-UHFFFAOYSA-N.
| Molecular formula | C15H10FNO2 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-[(3-fluorophenyl)methyl]isoindole-1,3-dione |
| InChIKey | APYCABOCKVIWAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC(=CC=C3)F |
Computed by PubChem (NCBI)