Products 70216-78-3
CAS 70216-78-3 appears in our catalog under these names: 2–(3–fluorobenzyl)isoindoline–1，3–dione, 2-[(3-Fluorophenyl)methyl]isoindole-1,3-dione, 95%, 1H-Isoindole-1,3(2H)-dione,2-((3-fluorophenyl)methyl)-, 95%, 2-[(3-fluorophenyl)methyl]-2,3-dihydro-1H-isoindole-1,3-dione, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 25g.
2-[(3-fluorophenyl)methyl]isoindole-1,3-dione (CAS 70216-78-3) is a chemical compound with the molecular formula C15H10FNO2 and a molecular weight of 255.24 g/mol. IUPAC name: 2-[(3-fluorophenyl)methyl]isoindole-1,3-dione. InChIKey: APYCABOCKVIWAT-UHFFFAOYSA-N.
| Molecular formula | C15H10FNO2 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-[(3-fluorophenyl)methyl]isoindole-1,3-dione |
| InChIKey | APYCABOCKVIWAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CC3=CC(=CC=C3)F |
Computed by PubChem (NCBI)