1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, sodium salt (1:1), 97%, 97%
cas: 1198-77-2 — see every product listed under this CAS number, including other names
1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, sodium salt (1:1), 97%, 97% (CAS 1198-77-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PON-100g |
| cas | 1198-77-2 |
| size | 100g |
| availability | 200g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 3683.60 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 342.80 Pln | |
| Chemat | 25g | 1091.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Sodium 2,6-dioxo-3,7-dihydropurin-8-olate (CAS 1198-77-2) is a chemical compound with the molecular formula C5H3N4NaO3 and a molecular weight of 190.09 g/mol. IUPAC name: sodium 2,6-dioxo-3,7-dihydropurin-8-olate. InChIKey: NAFSTSRULRIERK-UHFFFAOYSA-M.
| Molecular formula | C5H3N4NaO3 |
|---|---|
| Molecular weight | 190.09 g/mol |
| IUPAC name | sodium 2,6-dioxo-3,7-dihydropurin-8-olate |
| InChIKey | NAFSTSRULRIERK-UHFFFAOYSA-M |
| SMILES | C12=C(NC(=O)NC1=O)N=C(N2)[O-].[Na+] |
Computed by PubChem (NCBI)
Synonyms:
Uric acid sodium salt, Monosodium urate, SODIUM URATE, Uric acid, monosodium salt, 7,9-Dihydro-1H-purine-2,6,8(3H)-trione sodium salt, 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, sodium salt, 1H-Purine-2,6,8(3H)-trione, 7,9-dihydro-, monosodium salt, Uric acid sodium, Uric acid (sodium), Dinatriumurat