CAS 1198-77-2 appears in our catalog under these names: Uric Acid (sodium salt) (Standard), Uric acid, sodium, 25 g, Uric acid sodium salt, 95%, Uric acid sodium/ 99.92% (existing batch purity), Uric acid sodium. Offered by: GLPBio, Roth, Combi-blocks, TargetMol, Biosynth. Available pack sizes: 2mg, 25g, 1g, 100mg, 200mg, 500mg, 50g, 10mg.
Sodium 2,6-dioxo-3,7-dihydropurin-8-olate (CAS 1198-77-2) is a chemical compound with the molecular formula C5H3N4NaO3 and a molecular weight of 190.09 g/mol. IUPAC name: sodium 2,6-dioxo-3,7-dihydropurin-8-olate. InChIKey: NAFSTSRULRIERK-UHFFFAOYSA-M.
| Molecular formula | C5H3N4NaO3 |
|---|---|
| Molecular weight | 190.09 g/mol |
| IUPAC name | sodium 2,6-dioxo-3,7-dihydropurin-8-olate |
| InChIKey | NAFSTSRULRIERK-UHFFFAOYSA-M |
| SMILES | C12=C(NC(=O)NC1=O)N=C(N2)[O-].[Na+] |
Computed by PubChem (NCBI)