cas: 942070-94-2 — see every product listed under this CAS number, including other names
1H-Pyrazole-1-carboxamide, N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, 98%, 98% (CAS 942070-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1176YD-100mg |
| cas | 942070-94-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 794.00 Pln | |
| Chemat | 1g | 1907.60 Pln | |
| Chemat | 5g | 5046.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide (CAS 942070-94-2) is a chemical compound with the molecular formula C12H20BN3O3 and a molecular weight of 265.12 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide. InChIKey: JZLIBMJAXDJTTD-UHFFFAOYSA-N.
| Molecular formula | C12H20BN3O3 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide |
| InChIKey | JZLIBMJAXDJTTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(=O)N(C)C |
Computed by PubChem (NCBI)