cas: 942070-94-2 — see every product listed under this CAS number, including other names
N,N-Dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole-1-carboxamide 98% (CAS 942070-94-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A628496-100mg |
| cas | 942070-94-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 832.06 Pln | |
| Ambeed | 1g | 1983.50 Pln | |
| Ambeed | 5g | 6828.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A628496 |
N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide (CAS 942070-94-2) is a chemical compound with the molecular formula C12H20BN3O3 and a molecular weight of 265.12 g/mol. IUPAC name: N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide. InChIKey: JZLIBMJAXDJTTD-UHFFFAOYSA-N.
| Molecular formula | C12H20BN3O3 |
|---|---|
| Molecular weight | 265.12 g/mol |
| IUPAC name | N,N-dimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole-1-carboxamide |
| InChIKey | JZLIBMJAXDJTTD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN(N=C2)C(=O)N(C)C |
Computed by PubChem (NCBI)