cas: 303180-11-2 — see every product listed under this CAS number, including other names
1H-Pyrazole-3,5-dicarboxylic acid hydrate 97% (CAS 303180-11-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A175706-1g |
| cas | 303180-11-2 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 392.62 Pln | |
| Ambeed | 500g | 1666.44 Pln | |
| Ambeed | 1000g | 3101.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A175706 |
1H-pyrazole-3,5-dicarboxylic acid;hydrate (CAS 303180-11-2) is a chemical compound with the molecular formula C5H6N2O5 and a molecular weight of 174.11 g/mol. IUPAC name: 1H-pyrazole-3,5-dicarboxylic acid;hydrate. InChIKey: GLINCONFUZIMCN-UHFFFAOYSA-N.
| Molecular formula | C5H6N2O5 |
|---|---|
| Molecular weight | 174.11 g/mol |
| IUPAC name | 1H-pyrazole-3,5-dicarboxylic acid;hydrate |
| InChIKey | GLINCONFUZIMCN-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)C(=O)O.O |
Computed by PubChem (NCBI)