CAS 1346602-15-0 appears in our catalog under these names: Orotic Acid-13C,15N2 Monohydrate, >95% (HPLC), Orotic acid–13C,15N2 monohydrate, Orotic acid-13C,15N2 (monohydrate), 99.93%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
2,4-dioxo-(213C,1,3-15N2)1H-pyrimidine-6-carboxylic acid;hydrate (CAS 1346602-15-0) is a chemical compound with the molecular formula C5H6N2O5 and a molecular weight of 177.09 g/mol. IUPAC name: 2,4-dioxo-(213C,1,3-15N2)1H-pyrimidine-6-carboxylic acid;hydrate. InChIKey: YXUZGLGRBBHYFZ-RYBQTAQPSA-N.
| Molecular formula | C5H6N2O5 |
|---|---|
| Molecular weight | 177.09 g/mol |
| IUPAC name | 2,4-dioxo-(213C,1,3-15N2)1H-pyrimidine-6-carboxylic acid;hydrate |
| InChIKey | YXUZGLGRBBHYFZ-RYBQTAQPSA-N |
| SMILES | C1=C([15NH][13C](=O)[15NH]C1=O)C(=O)O.O |
Computed by PubChem (NCBI)