2'-(Phenyldiazenyl)-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95%
cas: 1435279-35-8 — see every product listed under this CAS number, including other names
2'-(Phenyldiazenyl)-[1,1':4',1''-terphenyl]-4,4''-dicarboxylic acid, 95% (CAS 1435279-35-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1494740-100mg |
| cas | 1435279-35-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 676.31 Pln | |
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 2829.00 Pln | |
| BLDpharm | 100mg | 725.32 Pln | |
| BLDpharm | 250mg | 1180.72 Pln | |
| BLDpharm | 1g | 3041.18 Pln | |
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 1053.20 Pln | |
| Chemat | 1g | 2733.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-[4-(4-carboxyphenyl)-3-phenyldiazenylphenyl]benzoic acid (CAS 1435279-35-8) is a chemical compound with the molecular formula C26H18N2O4 and a molecular weight of 422.4 g/mol. IUPAC name: 4-[4-(4-carboxyphenyl)-3-phenyldiazenylphenyl]benzoic acid. InChIKey: NVQFHMAGCYDRGO-UHFFFAOYSA-N.
| Molecular formula | C26H18N2O4 |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | 4-[4-(4-carboxyphenyl)-3-phenyldiazenylphenyl]benzoic acid |
| InChIKey | NVQFHMAGCYDRGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC(=C2)C3=CC=C(C=C3)C(=O)O)C4=CC=C(C=C4)C(=O)O |
Computed by PubChem (NCBI)