CAS 148-85-6 is the registry number for 4′,4′′′-(1,2-Diazenediyl)bis[1,1′-biphenyl]-4-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[4-[[4-(4-carboxyphenyl)phenyl]diazenyl]phenyl]benzoic acid (CAS 148-85-6) is a chemical compound with the molecular formula C26H18N2O4 and a molecular weight of 422.4 g/mol. IUPAC name: 4-[4-[[4-(4-carboxyphenyl)phenyl]diazenyl]phenyl]benzoic acid. InChIKey: QODCKSFTCDHBIO-UHFFFAOYSA-N.
| Molecular formula | C26H18N2O4 |
|---|---|
| Molecular weight | 422.4 g/mol |
| IUPAC name | 4-[4-[[4-(4-carboxyphenyl)phenyl]diazenyl]phenyl]benzoic acid |
| InChIKey | QODCKSFTCDHBIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)N=NC3=CC=C(C=C3)C4=CC=C(C=C4)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)