cas: 1009-22-9 — see every product listed under this CAS number, including other names
2'-Bromo-4'-fluoroacetanilide, 98% (CAS 1009-22-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013199-5G |
| cas | 1009-22-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 560.24 Pln | |
| Fluorochem | 500g | 1752.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-bromo-4-fluorophenyl)acetamide (CAS 1009-22-9) is a chemical compound with the molecular formula C8H7BrFNO and a molecular weight of 232.05 g/mol. IUPAC name: N-(2-bromo-4-fluorophenyl)acetamide. InChIKey: JAVSBNOXENOHEI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | N-(2-bromo-4-fluorophenyl)acetamide |
| InChIKey | JAVSBNOXENOHEI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)