CAS 1009-22-9 appears in our catalog under these names: N-Acetyl 2-bromo-4-fluoroaniline, 96%, 2'-Bromo-4'-fluoroacetanilide, 2'-Bromo-4'-fluoroacetanilide, >98.0%(GC), 2'-Bromo-4'-fluoroacetanilide, 98%. Offered by: Combi-blocks, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 500g, 25g, 5g, 250g, 1000g.
N-(2-bromo-4-fluorophenyl)acetamide (CAS 1009-22-9) is a chemical compound with the molecular formula C8H7BrFNO and a molecular weight of 232.05 g/mol. IUPAC name: N-(2-bromo-4-fluorophenyl)acetamide. InChIKey: JAVSBNOXENOHEI-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | N-(2-bromo-4-fluorophenyl)acetamide |
| InChIKey | JAVSBNOXENOHEI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)F)Br |
Computed by PubChem (NCBI)