cas: 614-83-5 — see every product listed under this CAS number, including other names
2'-Bromo-4'-methylacetanilide, >98.0%(N)(GC) (CAS 614-83-5) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0125-10G |
| cas | 614-83-5 |
| size | 10g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 10g | 354.37 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(N)(GC) |
N-(2-bromo-4-methylphenyl)acetamide (CAS 614-83-5) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: N-(2-bromo-4-methylphenyl)acetamide. InChIKey: UUDGTWKIIUEVJD-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | N-(2-bromo-4-methylphenyl)acetamide |
| InChIKey | UUDGTWKIIUEVJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C)Br |
Computed by PubChem (NCBI)