CAS 1290634-39-7 appears in our catalog under these names: 5-Bromo-n,2-dimethylbenzamide, 95%, 5-Bromo-N,2-dimethylbenzamide, 5-Bromo-N,2-dimethylbenzamide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 2,5g, 100mg.
5-bromo-N,2-dimethylbenzamide (CAS 1290634-39-7) is a chemical compound with the molecular formula C9H10BrNO and a molecular weight of 228.09 g/mol. IUPAC name: 5-bromo-N,2-dimethylbenzamide. InChIKey: HQMSFKCYMRDNAE-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO |
|---|---|
| Molecular weight | 228.09 g/mol |
| IUPAC name | 5-bromo-N,2-dimethylbenzamide |
| InChIKey | HQMSFKCYMRDNAE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Br)C(=O)NC |
Computed by PubChem (NCBI)