cas: 122111-03-9 — see every product listed under this CAS number, including other names
2'-Deoxy-2',2'-difluorocytidine Hydrochloride, 99% (CAS 122111-03-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114QQQ-100mg |
| cas | 122111-03-9 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 371.60 Pln | |
| Chemat | 50g | 674.00 Pln | |
| Chemat | 100g | 1221.20 Pln | |
| Chemat | 250g | 2637.20 Pln | |
| Chemat | 500g | 4920.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride (CAS 122111-03-9) is a chemical compound with the molecular formula C9H12ClF2N3O4 and a molecular weight of 299.66 g/mol. IUPAC name: 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride. InChIKey: OKKDEIYWILRZIA-OSZBKLCCSA-N.
| Molecular formula | C9H12ClF2N3O4 |
|---|---|
| Molecular weight | 299.66 g/mol |
| IUPAC name | 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride |
| InChIKey | OKKDEIYWILRZIA-OSZBKLCCSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F.Cl |
Computed by PubChem (NCBI)