cas: 122111-03-9 — see every product listed under this CAS number, including other names
Gemcitabine hydrochloride, 98% (CAS 122111-03-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 25g, 50g, 100g. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 461060010 |
| cas | 122111-03-9 |
| size | 1g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 485.54 Pln | |
| Thermo Scientific (Acros) | 5g | 1443.24 Pln | |
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 216.61 Pln | |
| Fluorochem | 10g | 305.12 Pln | |
| Fluorochem | 25g | 622.72 Pln | |
| Fluorochem | 50g | 1148.57 Pln | |
| Fluorochem | 100g | 2085.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride (CAS 122111-03-9) is a chemical compound with the molecular formula C9H12ClF2N3O4 and a molecular weight of 299.66 g/mol. IUPAC name: 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride. InChIKey: OKKDEIYWILRZIA-OSZBKLCCSA-N.
| Molecular formula | C9H12ClF2N3O4 |
|---|---|
| Molecular weight | 299.66 g/mol |
| IUPAC name | 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydrochloride |
| InChIKey | OKKDEIYWILRZIA-OSZBKLCCSA-N |
| SMILES | C1=CN(C(=O)N=C1N)[C@H]2C([C@@H]([C@H](O2)CO)O)(F)F.Cl |
Computed by PubChem (NCBI)