cas: 321-62-0 — see every product listed under this CAS number, including other names
2'-Fluoro-[1,1'-biphenyl]-4-ol, 97% (CAS 321-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772838-1G |
| cas | 321-62-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1695.25 Pln | |
| Fluorochem | 5g | 5355.42 Pln | |
| Fluorochem | 10g | 8588.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-(2-fluorophenyl)phenol (CAS 321-62-0) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 4-(2-fluorophenyl)phenol. InChIKey: FEHGAYLOAATVGN-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 4-(2-fluorophenyl)phenol |
| InChIKey | FEHGAYLOAATVGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)O)F |
Computed by PubChem (NCBI)