CAS 477860-13-2 appears in our catalog under these names: 2–fluoro–(1,1'–biphenyl)–4–ol, 2-Fluoro-(1,1'-biphenyl)-4-ol, 98%, 3-Fluoro-4-phenylphenol, 96%, Flurbiprofen Impurity 9, 3-Fluoro-4-phenylphenol, >95% (HPLC). Offered by: GLPBio, AmBeed, Combi-blocks, Chemat Brand, TRC. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 5g, 1g, on request, 500mg.
3-fluoro-4-phenylphenol (CAS 477860-13-2) is a chemical compound with the molecular formula C12H9FO and a molecular weight of 188.20 g/mol. IUPAC name: 3-fluoro-4-phenylphenol. InChIKey: ZAYRUOZNLRMSTL-UHFFFAOYSA-N.
| Molecular formula | C12H9FO |
|---|---|
| Molecular weight | 188.20 g/mol |
| IUPAC name | 3-fluoro-4-phenylphenol |
| InChIKey | ZAYRUOZNLRMSTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=C(C=C2)O)F |
Computed by PubChem (NCBI)