CAS 205171-12-6 appears in our catalog under these names: 2'-MeCCPA/ 99.93% (existing batch purity), 2'–MeCCPA, 2'-Meccpa, 2'-MeCCPA 99%, 2'-MeCCPA, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
(2R,3R,4R,5R)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 205171-12-6) is a chemical compound with the molecular formula C16H22ClN5O4 and a molecular weight of 383.8 g/mol. IUPAC name: (2R,3R,4R,5R)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: MMPAUXMIDJWGFO-ROMFRFKVSA-N.
| Molecular formula | C16H22ClN5O4 |
|---|---|
| Molecular weight | 383.8 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | MMPAUXMIDJWGFO-ROMFRFKVSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=NC3=C(N=C(N=C32)Cl)NC4CCCC4)CO)O)O |
Computed by PubChem (NCBI)