CAS 2226475-42-7 appears in our catalog under these names: 2'-O-(2-Azidoethyl)adenosine/ 95%, 2'-O-(2-Azidoethyl)adenosine, 2’-O-(2-Azidoethyl)adenosine. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 10 mg, 1 mg, 5 mg.
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(2-azidoethoxy)-2-(hydroxymethyl)oxolan-3-ol (CAS 2226475-42-7) is a chemical compound with the molecular formula C12H16N8O4 and a molecular weight of 336.31 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(2-azidoethoxy)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: KINSUEWJJFEOQZ-WOUKDFQISA-N.
| Molecular formula | C12H16N8O4 |
|---|---|
| Molecular weight | 336.31 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-(2-azidoethoxy)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | KINSUEWJJFEOQZ-WOUKDFQISA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)OCCN=[N+]=[N-])N |
Computed by PubChem (NCBI)