cas: 3883-86-1 — see every product listed under this CAS number, including other names
2,2',3,3',5,5',6,6'-Octafluorobiphenyl, >97.0%(GC) (CAS 3883-86-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | O0182-1G |
| cas | 3883-86-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 177.35 Pln | |
| TCI | 5g | 526.48 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene (CAS 3883-86-1) is a chemical compound with the molecular formula C12H2F8 and a molecular weight of 298.13 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene. InChIKey: QWCHHUZAAGRHDB-UHFFFAOYSA-N.
| Molecular formula | C12H2F8 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene |
| InChIKey | QWCHHUZAAGRHDB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C2=C(C(=CC(=C2F)F)F)F)F)F |
Computed by PubChem (NCBI)