CAS 3883-86-1 appears in our catalog under these names: 4H,4'H-Octafluorobiphenyl, 97%, 2,2',3,3',5,5',6,6'-Octafluoro-1,1'-biphenyl, 98%, 2,2',3,3',5,5',6,6'–Octafluorobiphenyl, 2,2',3,3',5,5',6,6'-Octafluorobiphenyl, 2,2',3,3',5,5',6,6'-Octafluorobiphenyl, >97.0%(GC). Offered by: Combi-blocks, Chemat Brand, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 5g, 25g, on request, 500mg, 1000mg, 2000mg, 5000mg.
1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene (CAS 3883-86-1) is a chemical compound with the molecular formula C12H2F8 and a molecular weight of 298.13 g/mol. IUPAC name: 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene. InChIKey: QWCHHUZAAGRHDB-UHFFFAOYSA-N.
| Molecular formula | C12H2F8 |
|---|---|
| Molecular weight | 298.13 g/mol |
| IUPAC name | 1,2,4,5-tetrafluoro-3-(2,3,5,6-tetrafluorophenyl)benzene |
| InChIKey | QWCHHUZAAGRHDB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)C2=C(C(=CC(=C2F)F)F)F)F)F |
Computed by PubChem (NCBI)