cas: 7484-34-6 — see every product listed under this CAS number, including other names
2,2'-(Ethane-1,2-diyldisulfonyl)diethanol, 97% (CAS 7484-34-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F362068-1G |
| cas | 7484-34-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1419.31 Pln | |
| Fluorochem | 5g | 5922.93 Pln | |
| Fluorochem | 10g | 11327.28 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-(2-hydroxyethylsulfonyl)ethylsulfonyl]ethanol (CAS 7484-34-6) is a chemical compound with the molecular formula C6H14O6S2 and a molecular weight of 246.3 g/mol. IUPAC name: 2-[2-(2-hydroxyethylsulfonyl)ethylsulfonyl]ethanol. InChIKey: ZXTWNSRETGZRGO-UHFFFAOYSA-N.
| Molecular formula | C6H14O6S2 |
|---|---|
| Molecular weight | 246.3 g/mol |
| IUPAC name | 2-[2-(2-hydroxyethylsulfonyl)ethylsulfonyl]ethanol |
| InChIKey | ZXTWNSRETGZRGO-UHFFFAOYSA-N |
| SMILES | C(CS(=O)(=O)CCS(=O)(=O)CCO)O |
Computed by PubChem (NCBI)