CAS 116653-28-2 appears in our catalog under these names: Busulfan-D8, Busulfan-d8 (tetramethylene-d8), 99 atom % D, min 98% Chemical Purity, Busulfan–d8, D8-Busulfan, Busulfan-d8, 99.73%. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5mg, 0,1g.
(1,1,2,2,3,3,4,4-octadeuterio-4-methylsulfonyloxybutyl) methanesulfonate (CAS 116653-28-2) is a chemical compound with the molecular formula C6H14O6S2 and a molecular weight of 254.4 g/mol. IUPAC name: (1,1,2,2,3,3,4,4-octadeuterio-4-methylsulfonyloxybutyl) methanesulfonate. InChIKey: COVZYZSDYWQREU-SQUIKQQTSA-N.
| Molecular formula | C6H14O6S2 |
|---|---|
| Molecular weight | 254.4 g/mol |
| IUPAC name | (1,1,2,2,3,3,4,4-octadeuterio-4-methylsulfonyloxybutyl) methanesulfonate |
| InChIKey | COVZYZSDYWQREU-SQUIKQQTSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])OS(=O)(=O)C)C([2H])([2H])OS(=O)(=O)C |
Computed by PubChem (NCBI)