cas: 84783-64-2 — see every product listed under this CAS number, including other names
2,2'-Bis(diphenylphosphino)-1,1'-biphenyl, 98% (CAS 84783-64-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F791121-250MG |
| cas | 84783-64-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 500mg | 362.39 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1809.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-(2-diphenylphosphanylphenyl)phenyl]-diphenylphosphane (CAS 84783-64-2) is a chemical compound with the molecular formula C36H28P2 and a molecular weight of 522.6 g/mol. IUPAC name: [2-(2-diphenylphosphanylphenyl)phenyl]-diphenylphosphane. InChIKey: GRTJBNJOHNTQBO-UHFFFAOYSA-N.
| Molecular formula | C36H28P2 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | [2-(2-diphenylphosphanylphenyl)phenyl]-diphenylphosphane |
| InChIKey | GRTJBNJOHNTQBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3C4=CC=CC=C4P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)