CAS 4129-44-6 appears in our catalog under these names: 4,4'-Bis(diphenylphosphanyl)-1,1'-biphenyl, 98%, 4,4'-Bis(diphenylphosphanyl)-1,1'-biphenyl 98%, 4,4'-Bis(diphenylphosphino)biphenyl, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
[4-(4-diphenylphosphanylphenyl)phenyl]-diphenylphosphane (CAS 4129-44-6) is a chemical compound with the molecular formula C36H28P2 and a molecular weight of 522.6 g/mol. IUPAC name: [4-(4-diphenylphosphanylphenyl)phenyl]-diphenylphosphane. InChIKey: RJUKHLSOORRJLL-UHFFFAOYSA-N.
| Molecular formula | C36H28P2 |
|---|---|
| Molecular weight | 522.6 g/mol |
| IUPAC name | [4-(4-diphenylphosphanylphenyl)phenyl]-diphenylphosphane |
| InChIKey | RJUKHLSOORRJLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=C(C=C3)C4=CC=C(C=C4)P(C5=CC=CC=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)