2,2'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-diamine, 98%
cas: 341-58-2 — see every product listed under this CAS number, including other names
2,2'-Bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-diamine, 98% (CAS 341-58-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A150373-1g |
| cas | 341-58-2 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 337.00 Pln | |
| Ambeed | 500g | 1115.75 Pln | |
| Ambeed | 1kg | 2161.50 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 10g | 153.30 Pln | |
| BLDpharm | 25g | 236.61 Pln | |
| BLDpharm | 100g | 353.23 Pln | |
| BLDpharm | 500g | 1197.38 Pln | |
| BLDpharm | 1kg | 2324.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline (CAS 341-58-2) is a chemical compound with the molecular formula C14H10F6N2 and a molecular weight of 320.23 g/mol. IUPAC name: 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline. InChIKey: NVKGJHAQGWCWDI-UHFFFAOYSA-N.
| Molecular formula | C14H10F6N2 |
|---|---|
| Molecular weight | 320.23 g/mol |
| IUPAC name | 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
| InChIKey | NVKGJHAQGWCWDI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)C2=C(C=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
[1,1'-Biphenyl]-4,4'-diamine, 2,2'-bis(trifluoromethyl)-, (1,1'-Biphenyl)-4,4'-diamine, 2,2'-bis(trifluoromethyl)-, 2,2'-Bis(trifluoromethyl)benzidine, 2,2'-bis(trifluoromethyl)-[1,1'-biphenyl]-4,4'-diamine, 4-[4-amino-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline, TFMB, 2,2'-Bis(trifluoromethyl)-4,4'-diaminobiphenyl, 2,2'-Bis-trifluoromethyl-biphenyl-4,4'-diamine, 4,4'-Diamino-2,2'-bis(trifluoromethyl)biphenyl, 2,2'-Bis(trifluoromethyl)-4,4'-biphenyldiamine