CAS 174612-10-3 is the registry number for 3,3'-Diamino-5,5'-bis(trifluoromethyl)biphenyl, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-[3-amino-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)aniline (CAS 174612-10-3) is a chemical compound with the molecular formula C14H10F6N2 and a molecular weight of 320.23 g/mol. IUPAC name: 3-[3-amino-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)aniline. InChIKey: NPVLUNVCARVDIJ-UHFFFAOYSA-N.
| Molecular formula | C14H10F6N2 |
|---|---|
| Molecular weight | 320.23 g/mol |
| IUPAC name | 3-[3-amino-5-(trifluoromethyl)phenyl]-5-(trifluoromethyl)aniline |
| InChIKey | NPVLUNVCARVDIJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)N)C2=CC(=CC(=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)