cas: 239075-02-6 — see every product listed under this CAS number, including other names
2,2'-Bithiophene-5,5'-diboronic acid bis(pinacol), 98% (CAS 239075-02-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F047636-1G |
| cas | 239075-02-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 685.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane (CAS 239075-02-6) is a chemical compound with the molecular formula C20H28B2O4S2 and a molecular weight of 418.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: XWWXVHGWYCXJCJ-UHFFFAOYSA-N.
| Molecular formula | C20H28B2O4S2 |
|---|---|
| Molecular weight | 418.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | XWWXVHGWYCXJCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=C(S3)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)