cas: 239075-02-6 — see every product listed under this CAS number, including other names
5,5'-Bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,2'-bithiophene, >98.0%(T) (CAS 239075-02-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3363-5G |
| cas | 239075-02-6 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 939.53 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane (CAS 239075-02-6) is a chemical compound with the molecular formula C20H28B2O4S2 and a molecular weight of 418.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: XWWXVHGWYCXJCJ-UHFFFAOYSA-N.
| Molecular formula | C20H28B2O4S2 |
|---|---|
| Molecular weight | 418.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiophen-2-yl]thiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | XWWXVHGWYCXJCJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=C(S3)B4OC(C(O4)(C)C)(C)C |
Computed by PubChem (NCBI)