cas: 33284-21-8 — see every product listed under this CAS number, including other names
2,2,2-Trifluoro-1-(pyridin-3-yl)ethanone, 95%, 95% (CAS 33284-21-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C16L-100mg |
| cas | 33284-21-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 1g | 986.00 Pln | |
| Chemat | 5g | 3674.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2,2,2-trifluoro-1-pyridin-3-ylethanone (CAS 33284-21-8) is a chemical compound with the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. IUPAC name: 2,2,2-trifluoro-1-pyridin-3-ylethanone. InChIKey: PUFPXTQTBPNXAD-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO |
|---|---|
| Molecular weight | 175.11 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-pyridin-3-ylethanone |
| InChIKey | PUFPXTQTBPNXAD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)