CAS 207919-09-3 appears in our catalog under these names: 2,3,4-Trifluorobenzamide, 97%, 2,3,4-Trifluorobenzamide, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 100g.
2,3,4-trifluorobenzamide (CAS 207919-09-3) is a chemical compound with the molecular formula C7H4F3NO and a molecular weight of 175.11 g/mol. IUPAC name: 2,3,4-trifluorobenzamide. InChIKey: XGOGYOBKQVLGAY-UHFFFAOYSA-N.
| Molecular formula | C7H4F3NO |
|---|---|
| Molecular weight | 175.11 g/mol |
| IUPAC name | 2,3,4-trifluorobenzamide |
| InChIKey | XGOGYOBKQVLGAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)N)F)F)F |
Computed by PubChem (NCBI)