cas: 433-06-7 — see every product listed under this CAS number, including other names
2,2,2-Trifluoroethyl 4-methylbenzenesulfonate, 98%, 98% (CAS 433-06-7) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 10kg, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B3V-1kg |
| cas | 433-06-7 |
| size | 1kg |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 1014.80 Pln | |
| Chemat | 5kg | 4156.80 Pln | |
| Chemat | 10kg | price on request | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 146.00 Pln | |
| Chemat | 500g | 556.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,2,2-trifluoroethyl 4-methylbenzenesulfonate (CAS 433-06-7) is a chemical compound with the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. IUPAC name: 2,2,2-trifluoroethyl 4-methylbenzenesulfonate. InChIKey: IGKCQDUYZULGBM-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O3S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl 4-methylbenzenesulfonate |
| InChIKey | IGKCQDUYZULGBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)