cas: 433-06-7 — see every product listed under this CAS number, including other names
2,2,2-Trifluoroethyl p-toluenesulfonate, 97% (CAS 433-06-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F001538-1G |
| cas | 433-06-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 81.24 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 216.61 Pln | |
| Fluorochem | 500g | 784.12 Pln | |
| Fluorochem | 1kg | 1299.56 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97% |
2,2,2-trifluoroethyl 4-methylbenzenesulfonate (CAS 433-06-7) is a chemical compound with the molecular formula C9H9F3O3S and a molecular weight of 254.23 g/mol. IUPAC name: 2,2,2-trifluoroethyl 4-methylbenzenesulfonate. InChIKey: IGKCQDUYZULGBM-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O3S |
|---|---|
| Molecular weight | 254.23 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl 4-methylbenzenesulfonate |
| InChIKey | IGKCQDUYZULGBM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)