cas: 85951-09-3 — see every product listed under this CAS number, including other names
2,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-ol, 98%, 98% (CAS 85951-09-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1g, 5g, 10g, 25g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115MLC-50g |
| cas | 85951-09-3 |
| size | 50g |
| availability | 575g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 510.80 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 25g | 299.60 Pln | |
| Chemat | 100g | 914.00 Pln | |
| Chemat | 250g | 1874.00 Pln | |
| Chemat | 500g | 3120.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ol (CAS 85951-09-3) is a chemical compound with the molecular formula C15H36O3Si2 and a molecular weight of 320.61 g/mol. IUPAC name: 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ol. InChIKey: BICVCKKJDDTEIV-UHFFFAOYSA-N.
| Molecular formula | C15H36O3Si2 |
|---|---|
| Molecular weight | 320.61 g/mol |
| IUPAC name | 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ol |
| InChIKey | BICVCKKJDDTEIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)