CAS 85951-09-3 appears in our catalog under these names: 1,3-Bis(tert-Butyldimethylsiloxy)-2-propanol, 2,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-ol 90%, 2,2,3,3,9,9,10,10-Octamethyl-4,8-dioxa-3,9-disilaundecan-6-ol, 98%, 98%, 2,2,3,3,9,9,10,10-OCTAMETHYL-4,8-DIOXA-3,9-DISILAUNDECAN-6-OL, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 100g, 500g, 50g, 1g, 250g.
1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ol (CAS 85951-09-3) is a chemical compound with the molecular formula C15H36O3Si2 and a molecular weight of 320.61 g/mol. IUPAC name: 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ol. InChIKey: BICVCKKJDDTEIV-UHFFFAOYSA-N.
| Molecular formula | C15H36O3Si2 |
|---|---|
| Molecular weight | 320.61 g/mol |
| IUPAC name | 1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propan-2-ol |
| InChIKey | BICVCKKJDDTEIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CO[Si](C)(C)C(C)(C)C)O |
Computed by PubChem (NCBI)