cas: 950-99-2 — see every product listed under this CAS number, including other names
2,2,5,7,8-Pentamethyl-6-chromanol, 95% (CAS 950-99-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F866315-250MG |
| cas | 950-99-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 263.47 Pln | |
| Fluorochem | 5g | 778.91 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol (CAS 950-99-2) is a chemical compound with the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. IUPAC name: 2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol. InChIKey: SEBPXHSZHLFWRL-UHFFFAOYSA-N.
| Molecular formula | C14H20O2 |
|---|---|
| Molecular weight | 220.31 g/mol |
| IUPAC name | 2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-ol |
| InChIKey | SEBPXHSZHLFWRL-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CCC(O2)(C)C)C(=C1O)C)C |
Computed by PubChem (NCBI)