CAS 142228-70-4 appears in our catalog under these names: 2,2,8-TRIMETHYLCHROMAN-4-ONE, ≥95%, 2,2,8-trimethyl-3,4-dihydro-2H-1-benzopyran-4-one, ≥95%, ≥95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2,2,8-trimethyl-3H-chromen-4-one (CAS 142228-70-4) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2,2,8-trimethyl-3H-chromen-4-one. InChIKey: ODHQKHRCZCLOBX-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2,2,8-trimethyl-3H-chromen-4-one |
| InChIKey | ODHQKHRCZCLOBX-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=O)CC(O2)(C)C |
Computed by PubChem (NCBI)