CAS 33795-08-3 is the registry number for 2,2-Dimethyl-1-phenylcyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
2,2-dimethyl-1-phenylcyclopropane-1-carboxylic acid (CAS 33795-08-3) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2,2-dimethyl-1-phenylcyclopropane-1-carboxylic acid. InChIKey: LWXTZDYJBKYJNP-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 2,2-dimethyl-1-phenylcyclopropane-1-carboxylic acid |
| InChIKey | LWXTZDYJBKYJNP-UHFFFAOYSA-N |
| SMILES | CC1(CC1(C2=CC=CC=C2)C(=O)O)C |
Computed by PubChem (NCBI)