Products 33795-08-3

CAS 33795-08-3 is the registry number for 2,2-Dimethyl-1-phenylcyclopropanecarboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-1-phenylcyclopropane-1-carboxylic acid (CAS 33795-08-3) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 2,2-dimethyl-1-phenylcyclopropane-1-carboxylic acid. InChIKey: LWXTZDYJBKYJNP-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14O2
Molecular weight190.24 g/mol
IUPAC name2,2-dimethyl-1-phenylcyclopropane-1-carboxylic acid
InChIKeyLWXTZDYJBKYJNP-UHFFFAOYSA-N
SMILESCC1(CC1(C2=CC=CC=C2)C(=O)O)C

Computed by PubChem (NCBI)